BD4648141
2,4-Dichloro-1-(dichloromethyl)benzene , 97% , 134-25-8
CAS NO.:134-25-8
Empirical Formula: C7H4Cl4
Molecular Weight: 229.92
MDL number: MFCD00043967
EINECS: 205-134-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB25.60 | In Stock |
|
| 250mg | RMB36.80 | In Stock |
|
| 1g | RMB92.00 | In Stock |
|
| 5g | RMB296.80 | In Stock |
|
| 25g | RMB1008.00 | In Stock |
|
| 100g | RMB3326.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 110-115℃ (1 Torr) |
| Density | 1.501±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| InChI | InChI=1S/C7H4Cl4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,7H |
| InChIKey | AQVKVGOTPBBVMS-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)Cl)=CC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 134-25-8 |
| EPA Substance Registry System | Benzene, 2,4-dichloro-1-(dichloromethyl)- (134-25-8) |
Description and Uses
2,4-Dichloro-1-(dichloromethyl)benzene is an intermediate for the preparation of 2,4-dichlorobenzaldehyde, which can be used for the production of fungicides such as diconazole.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H335-H411-H372 |
| Precautionary statements | P261-P273-P305+P351+P338 |
| TSCA | TSCA listed |
| HS Code | 2903998089 |





