BD4665441
Methoxydimethyl(phenyl)silane , 95% , 17881-88-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB76.00 | In Stock |
|
| 5g | RMB134.40 | In Stock |
|
| 25g | RMB464.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 82°C/28mm |
| refractive index | 1.4850 to 1.4890 |
| Flash point: | 82°C/28mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C9H14OSi/c1-10-11(2,3)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | REQXNMOSXYEQLM-UHFFFAOYSA-N |
| SMILES | C1([Si](OC)(C)C)=CC=CC=C1 |
| CAS DataBase Reference | 17881-88-8 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Risk Statements | 36/38 |
| Safety Statements | 26-37 |
| RIDADR | UN 1993 3/PG III |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
