BD4680441
6-Cyclohexyl-4-methyl-2H-pyran-2-one , 97% , 14818-35-0
Synonym(s):
6-Cyclohexyl-4-methyl-2-pyrone;Ciclopirox Olamine Impurity B (PhEur)
CAS NO.:14818-35-0
Empirical Formula: C12H16O2
Molecular Weight: 192.25
MDL number: MFCD00156296
EINECS: 236-382-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB60.80 | In Stock |
|
| 25g | RMB215.20 | In Stock |
|
| 100g | RMB568.00 | In Stock |
|
| 500g | RMB1964.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >47°C (dec.) |
| Boiling point: | 332.2±11.0 °C(Predicted) |
| Density | 1.088±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Light Sensitive |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C12H16O2/c1-9-7-11(14-12(13)8-9)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3 |
| InChIKey | GPKRKAFTZYODFF-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(C2CCCCC2)=CC(C)=C1 |
Description and Uses
6-Cyclohexyl-4-methyl-2H-pyran-2-one (Ciclopirox EP Impurity B) is a a dialkylated pyranone derivative.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2932206000 |
| Storage Class | 11 - Combustible Solids |




