BD4703841
2-((5-Chloropyridin-2-yl)amino)-2-oxoaceticacid , 97% , 552850-73-4
CAS NO.:552850-73-4
Empirical Formula: C7H5ClN2O3
Molecular Weight: 200.58
MDL number: MFCD12171750
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB113.60 | In Stock |
|
| 10g | RMB204.80 | In Stock |
|
| 25g | RMB368.80 | In Stock |
|
| 100g | RMB1319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.639±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| pka | -1.07±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | 1S/C7H5ClN2O3/c8-4-1-2-5(9-3-4)10-6(11)7(12)13/h1-3H,(H,12,13)(H,9,10,11) |
| InChIKey | UQMUSEDZBHNTTQ-UHFFFAOYSA-N |
| SMILES | O=C(C(O)=O)NC(C=C1)=NC=C1Cl |
| CAS DataBase Reference | 552850-73-4 |
Description and Uses
2-((5-Chloropyridin-2-yl)amino)-2-oxoacetic Acid is a reactant or reagent used in the synthesis of the blood coagulating enzyme factor Xa (FXa) inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Storage Class | 11 - Combustible Solids |



![tert-Butyl 7-oxo-2,6-diazaspiro[3.4]octane-2-carboxylate](https://img.chemicalbook.com/CAS2/GIF/1234616-51-3.gif)



