BD4708341
5-Formyl-2-methoxybenzenesulfonamide , 97% , 105764-07-6
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB982.40 | In Stock |
|
| 100mg | RMB1272.00 | In Stock |
|
| 250mg | RMB2040.00 | In Stock |
|
| 1g | RMB5100.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >155°C (dec.) |
| Boiling point: | 458.5±55.0 °C(Predicted) |
| Density | 1.397±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 9.72±0.60(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChI | 1S/C8H9NO4S/c1-13-7-3-2-6(5-10)4-8(7)14(9,11)12/h2-5H,1H3,(H2,9,11,12) |
| InChIKey | HZZZXVQYTQPBPF-UHFFFAOYSA-N |
| SMILES | [S](=O)(=O)(N)c1c(ccc(c1)C=O)OC |
Description and Uses
5-Formyl-2-methoxy-benzenesulfonamide (Tamsulosin EP Impurity E) is an impurity of Tamsulosin (T006350), a specific α1-adrenoceptor antagonist used in the treatment of benign prostatic hypertrophy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |




![2-Methoxy-5-[2-[[2-(2-methoxyphenoxy)ethyl]amino]propyl]benzenesulfonamide monohydrochloride](https://img.chemicalbook.com/CAS/20150408/GIF/80223-96-7.gif)


