BD4757841
(E)-1-Pentene-1-boronicAcidPinacolEster , 98% , 161395-96-6
Synonym(s):
E-2-(1-Pentenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;trans-1-Pentenylboronic acid pinacol ester
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB82.40 | In Stock |
|
| 250mg | RMB148.80 | In Stock |
|
| 1g | RMB380.80 | In Stock |
|
| 5g | RMB1348.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 110-111 °C28 mm Hg |
| Density | 0.884 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 181 °F |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | liquid |
| color | Light yellow |
| Water Solubility | Insoluble in water. |
| InChI | 1S/C11H21BO2/c1-6-7-8-9-12-13-10(2,3)11(4,5)14-12/h8-9H,6-7H2,1-5H3/b9-8+ |
| InChIKey | IMIHEZMTQOARIK-CMDGGOBGSA-N |
| SMILES | CCC\C=C\B1OC(C)(C)C(C)(C)O1 |
| CAS DataBase Reference | 161395-96-6 |
Description and Uses
(E)-1-Pentenylboronic Acid Pinacol Ester is a reagent in the BACE-1 inhibitory activity of acyl guanidines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 10 - Combustible liquids |



![1,4-Dioxaspiro[4,5]dec-7-en-8-boronic Acid Pinacol Ester](https://img.chemicalbook.com/CAS/GIF/680596-79-6.gif)



