BD4760941
1,4-Bis[(9S)-10,11-dihydro-6′-methoxycinchonan-9-yl]-9,10-anthracenedione , 98% , 176298-44-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB499.20 | In Stock |
|
| 250mg | RMB786.40 | In Stock |
|
| 1g | RMB1884.00 | In Stock |
|
| 5g | RMB7022.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165 °C(lit.) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 9.81±0.70(Predicted) |
| form | solid |
| Appearance | Light yellow to yellow Solid |
| optical activity | [α]/D -498° |
| InChIKey | QUIOWIWSMQWLNP-XJVYWJENSA-N |
| SMILES | CC[C@@H]1CN2CCC1CC2[C@@H](Oc3ccc(O[C@H](C4CC5CCN4C[C@H]5CC)c6ccnc7ccc(OC)cc67)c8C(=O)c9ccccc9C(=O)c38)c%10ccnc%11ccc(OC)cc%10%11 |
Description and Uses
Superior ligand for asymmetric dihydroxylation reactions of most olefins bearing aliphatic substituents or olefins having heteroatoms in the allylic position.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |

![1,4-Bis[(9S)-10,11-dihydro-6′-methoxycinchonan-9-yl]-9,10-anthracenedione](https://img.chemicalbook.com/CAS/GIF/176298-44-5.gif)



![2-[2-(Dimethylamino)ethoxy]benzaldehyde97%](https://img.chemicalbook.com/CAS/GIF/15182-06-6.gif)

