BD4761941
(R)-Benzyl2-(hydroxymethyl)pyrrolidine-1-carboxylate , 96% , 72597-18-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB102.40 | In Stock |
|
| 1g | RMB229.60 | In Stock |
|
| 5g | RMB680.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 382.0±25.0 °C(Predicted) |
| Density | 1.135 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 14.77±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | 53.5° (C=1.05 g/100ml, MEOH) |
| Major Application | peptide synthesis |
| InChI | 1S/C13H17NO3/c15-9-12-7-4-8-14(12)13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6,12,15H,4,7-10H2/t12-/m1/s1 |
| InChIKey | BJTNHGVCFWDNDP-GFCCVEGCSA-N |
| SMILES | OC[C@H]1CCCN1C(=O)OCc2ccccc2 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P301+P310+P330-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 25-36 |
| Safety Statements | 26-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
