BD4787141
N,N'-(Octane-1,8-diyl)bis(2,2-dichloroacetamide) , 95% , 1477-57-2
Synonym(s):
Bisdiamine;Bis-diamine;Fertilysin;N,N′-1,8-Octanediylbis[2,2-dichloro-acetamide; N,N′-Bis(dischloroacetyl)-1,8-octamethylenediamine
CAS NO.:1477-57-2
Empirical Formula: C12H20Cl4N2O2
Molecular Weight: 366.11
MDL number: MFCD00000841
EINECS: 216-033-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB81.60 | In Stock |
|
| 250mg | RMB119.20 | In Stock |
|
| 1g | RMB318.40 | In Stock |
|
| 5g | RMB972.80 | In Stock |
|
| 25g | RMB2860.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120 °C |
| Boiling point: | 530℃ |
| Density | 0.726 |
| refractive index | 1.6200 (estimate) |
| Flash point: | 275℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Acetone (Very Slightly), DMSO (Slightly), Methanol (Sparingly, Heated, Sonicated |
| pka | 12.28±0.46(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C12H20Cl4N2O2/c13-9(14)11(19)17-7-5-3-1-2-4-6-8-18-12(20)10(15)16/h9-10H,1-8H2,(H,17,19)(H,18,20) |
| InChIKey | FAOMZVDZARKPFJ-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCCCCCNC(C(Cl)Cl)=O)C(Cl)Cl |
| CAS DataBase Reference | 1477-57-2 |
Description and Uses
Win 18446 was shown to inhibit the biosynthesis of retinoic acid from retinol in neonatal and adult murine testis and in the embryonic murine gonad.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H312+H332-H351 |
| Precautionary statements | P202-P261-P280-P302+P352+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 24/25-45-36 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Carc. 2 |
| Toxicity | LD50 orally in mice: >16000 mg/kg (Coulston) |






