BD4807441
Methyl4-bromo-1H-indazole-6-carboxylate , 97% , 885518-47-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB92.80 | In Stock |
|
| 250mg | RMB122.40 | In Stock |
|
| 1g | RMB312.00 | In Stock |
|
| 5g | RMB976.80 | In Stock |
|
| 10g | RMB1733.60 | In Stock |
|
| 25g | RMB3614.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 395.9±22.0 °C(Predicted) |
| Density | 1.709 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 11.21±0.40(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)5-2-7(10)6-4-11-12-8(6)3-5/h2-4H,1H3,(H,11,12) |
| InChIKey | DCYBEDQPCQOEIR-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(Br)=CC(C(OC)=O)=C2)C=N1 |
Description and Uses
Methyl 4-bromo-1H-indazole-6-carboxylate is used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
