BD4887541
(S)-2-Benzhydrylpyrrolidine , 98%99%ee , 119237-64-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB236.00 | In Stock |
|
| 1g | RMB502.40 | In Stock |
|
| 5g | RMB1671.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 135 °C0.01 mm Hg(lit.) |
| Density | 1.062 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 109 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| pka | 10.68±0.10(Predicted) |
| color | Clear colorless to pale yellow |
| optical activity | [α]24/D 3.0°, c = 1% in chloroform |
| InChI | InChI=1S/C17H19N/c1-3-8-14(9-4-1)17(16-12-7-13-18-16)15-10-5-2-6-11-15/h1-6,8-11,16-18H,7,12-13H2/t16-/m0/s1 |
| InChIKey | OXOBKZZXZVFOBB-INIZCTEOSA-N |
| SMILES | N1CCC[C@H]1C(C1=CC=CC=C1)C1=CC=CC=C1 |
Description and Uses
Used as excellent chiral solvating agents to determine the enantiomeric composition of chiral carboxylic acids directly by NMR analysis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
