BD4892941
2,4-Dimethylbenzene-1-sulfonylchloride , 95% , 609-60-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB72.80 | In Stock |
|
| 1g | RMB106.40 | In Stock |
|
| 5g | RMB356.80 | In Stock |
|
| 25g | RMB1506.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-33 °C |
| Boiling point: | 82°C/0.4mm |
| Density | 1.290±0.06 g/cm3(Predicted) |
| Flash point: | >110°(230°F) |
| refractive index | 1.5550 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | Off-White |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C8H9ClO2S/c1-6-3-4-8(7(2)5-6)12(9,10)11/h3-5H,1-2H3 |
| InChIKey | FREOGXBZEAMJQN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(C)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 609-60-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 2,4-dimethyl- (609-60-9) |
Description and Uses
2,4-Dimethylbenzenesulfonyl Chloride is used as a reagent in the synthesis of dimethyl benzimidazolones as potent and selective inhibitors of BRPF1 bromodomain. 2,4-Dimethylbenzenesulfonyl Chloride is also used as a reagent in the synthesis of quinazoline analogs as glucocerebrosidase inhibitors with chaperone activity for the treatment of Gaucher disease.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-51-24/25-22-7/9-6 |
| RIDADR | 3261 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2930909899 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |



