BD4921141
4-(2,5-Dioxo-2,5-dihydro-pyrrol-1-yl)-benzoicacid , 97% , 17057-04-4
CAS NO.:17057-04-4
Empirical Formula: C11H7NO4
Molecular Weight: 217.18
MDL number: MFCD00458571
EINECS: 241-117-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB77.60 | In Stock |
|
| 1g | RMB190.40 | In Stock |
|
| 5g | RMB771.20 | In Stock |
|
| 25g | RMB2313.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-228 °C |
| Boiling point: | 447.1±28.0 °C(Predicted) |
| Density | 1.521±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | powder to crystal |
| pka | 3.93±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C11H7NO4/c13-9-5-6-10(14)12(9)8-3-1-7(2-4-8)11(15)16/h1-6H,(H,15,16) |
| InChIKey | LKUOJDGRNKVVFF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N2C(=O)C=CC2=O)C=C1 |
| CAS DataBase Reference | 17057-04-4(CAS DataBase Reference) |
Description and Uses
4-Maleimidobenzoic acid is a protein crosslinker. 4-Maleimidobenzoic acid can be used to synthesis maleimidobenzoyl spacers[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |






