BD4936641
13-TetradecynoicAcid , 95% , 82909-47-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1180.00 | In Stock |
|
| 250mg | RMB2360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59.1°C (estimate) |
| Boiling point: | 384.08°C (rough estimate) |
| Density | 0.9192 (rough estimate) |
| refractive index | 1.4154 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml; Ethanol: 12.5 mg/ml; Ethanol:PBS (pH 7.2) (1:10): 0.1 mg/ml |
| form | Solid |
| pka | 4.78±0.10(Predicted) |
| color | Light yellow to brown |
| InChI | InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h1H,3-13H2,(H,15,16) |
| InChIKey | JNXXRQLAAJXERE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCCCCC#C |
Description and Uses
Alkynyl myristic acid can be used to identify and characterize the post-translational myristylated proteins with Click Chemistry.
Alkynyl myristic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Alkynyl myristic acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2916199590 |
