BD4970941
4-Bromo-2,6-dichlorobenzene-1-sulfonylchloride , 97% , 351003-54-8
CAS NO.:351003-54-8
Empirical Formula: C6H2BrCl3O2S
Molecular Weight: 324.41
MDL number: MFCD03094651
EINECS: 626-263-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB108.80 | In Stock |
|
| 5g | RMB381.60 | In Stock |
|
| 25g | RMB1512.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-42 °C (lit.) |
| Boiling point: | 349.8±42.0 °C(Predicted) |
| Density | 1.952±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | crystals |
| color | White to brown |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C6H2BrCl3O2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H |
| InChIKey | CKJIKXAPXLPSCL-UHFFFAOYSA-N |
| SMILES | Clc1cc(Br)cc(Cl)c1S(Cl)(=O)=O |
| CAS DataBase Reference | 351003-54-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



