BD4976541
T5601640 , 98% , 924473-59-6
Synonym(s):
3-Methyl-N-[3-[[[3-(trifluoromethyl)phenyl]amino]carbonyl]phenyl]-5-isoxazolecarboxamide;T5601640
CAS NO.:924473-59-6
Empirical Formula: C19H14F3N3O3
Molecular Weight: 389.33
MDL number:
EINECS: 604-604-1
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB679.20 | In Stock |
|
| 25mg | RMB1160.80 | In Stock |
|
| 50mg | RMB1973.60 | In Stock |
|
| 100mg | RMB3355.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 403.4±45.0 °C(Predicted) |
| Density | 1.426±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMF:PBS(pH7.2) (1:2): 0.33 mg/ml; DMSO: 20 mg/ml |
| pka | 11.41±0.70(Predicted) |
| form | powder |
| color | white to beige |
| InChI | 1S/C19H14F3N3O3/c1-11-8-16(28-25-11)18(27)24-14-6-2-4-12(9-14)17(26)23-15-7-3-5-13(10-15)19(20,21)22/h2-10H,1H3,(H,23,26)(H,24,27) |
| InChIKey | XVOKFRPKSAWELK-UHFFFAOYSA-N |
| SMILES | O=C(NC1=CC(C(F)(F)F)=CC=C1)C2=CC(NC(C3=CC(C)=NO3)=O)=CC=C2 |
Description and Uses
T 5601640 is a LIMK inhibitor and is used for the treatment of proliferative disorders such as cancer, neurofibromatosis and neuronal differentiation associated disaeses.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H413 |
| Precautionary statements | P273-P301+P310+P330 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 |



![3-(5-(4-(Cyclopentyloxy)-2-hydroxybenzoyl)-2-((3-hydroxybenzo[d]isoxazol-6-yl)methoxy)phenyl)propanoicacid](https://img.chemicalbook.com/CAS/GIF/530141-72-1.gif)

