PRODUCT Properties
| Melting point: | 199-204℃ | 
                                    
| Boiling point: | 345℃ | 
                                    
| alpha | D25 +13.7° (c = 2 in water) | 
                                    
| Density | 1.0048 (rough estimate) | 
                                    
| refractive index | 1.4610 (estimate) | 
                                    
| RTECS | EL3640000 | 
                                    
| Flash point: | >110°(230°F) | 
                                    
| storage temp. | Keep in dark place,Sealed in dry,2-8°C | 
                                    
| solubility | Soluble in DMSO | 
                                    
| form | Powder | 
                                    
| pka | pKa 6.6 (H2O) (Uncertain);9.5(H3O) (Uncertain) | 
                                    
| color | White to off-white | 
                                    
| Water Solubility | Soluble in water. Also soluble in chloroform and methylene chloride | 
                                    
| InChI | InChI=1S/C10H24N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3/t9-,10-/m0/s1 | 
                                    
| InChIKey | AEUTYOVWOVBAKS-UWVGGRQHSA-N | 
                                    
| SMILES | C(N[C@@H](CC)CO)CN[C@@H](CC)CO | 
                                    
Description and Uses
Ethambutol is an antitubercular antibiotic.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302 | 
| Precautionary statements | P264-P270-P301+P312a-P330-P501a | 
| Hazardous Substances Data | 74-55-5(Hazardous Substances Data) | 
| Toxicity | LD50 oral in rat: 998mg/kg | 






