BD4985541
Fmoc-β-HoGlu(OtBu)-OH , 98+% , 203854-49-3
Synonym(s):
(S)-3-(Fmoc-amino)adipic acid 6-tert-butyl ester;Fmoc-L -β-homoglutamic acid 6-tert-butyl ester
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB164.00 | In Stock |
|
| 250mg | RMB237.60 | In Stock |
|
| 1g | RMB569.60 | In Stock |
|
| 5g | RMB1991.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-120℃ |
| Boiling point: | 638.8±50.0 °C(Predicted) |
| Density | 1.214±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 4.31±0.10(Predicted) |
| color | White to off-white |
| Water Solubility | Slightly soluble in water. |
| BRN | 8019724 |
| InChIKey | XPCDWOCHPTYDPV-INIZCTEOSA-N |
| SMILES | C(O)(=O)C[C@@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CCC(OC(C)(C)C)=O |
| CAS DataBase Reference | 203854-49-3(CAS DataBase Reference) |
Description and Uses
N-Fmoc-L-beta-homoglutamic acid 6-tert-butyl ester is used as organic chemical synthesis intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
