BD4993841
3-Bromo-5-chlorotoluene , 97% , 329944-72-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB59.20 | In Stock |
|
| 10g | RMB114.40 | In Stock |
|
| 25g | RMB226.40 | In Stock |
|
| 100g | RMB782.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25℃ |
| Boiling point: | 222.3±20.0℃ (760 Torr) |
| Density | 1.535±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 101.5±11.9℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C7H6BrCl/c1-5-2-6(8)4-7(9)3-5/h2-4H,1H3 |
| InChIKey | YRIKDGJWRMHTJP-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C)=CC(Cl)=C1 |
Description and Uses
3-Bromo-5-chlorotoluene is a reagent used in the synthesis of novel benzophenones towards the discovery of potent, next generation HIV nonnucleoside reverse transcriptase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| Hazard Note | Irritant |
| HS Code | 2903998090 |
