tert-Butyl1-amino-3,6,9,12,15,18-hexaoxahenicosan-21-oate , 95% , 1286281-32-0
Synonym(s):
tert-Butyl 1-amino-3,6,9,12,15,18-hexaoxahenicosan-21-oate;H2N-PEG6-CH2CH2COOtBu
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB464.80 | In Stock |
|
| 250mg | RMB700.80 | In Stock |
|
| 1g | RMB1640.00 | In Stock |
|
| 5g | RMB4992.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 475.9±40.0 °C(Predicted) |
| Density | 1.056±0.06 g/cm3(Predicted) |
| refractive index | n/D 1.4562 |
| storage temp. | -20°C |
| pka | 8.74±0.10(Predicted) |
| form | Oil |
| color | Colorless to light yellow |
| InChI | InChI=1S/C19H39NO8/c1-19(2,3)28-18(21)4-6-22-8-10-24-12-14-26-16-17-27-15-13-25-11-9-23-7-5-20/h4-17,20H2,1-3H3 |
| InChIKey | QGSFECNPSLZGGT-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOCCOCCN |
Description and Uses
Amino-PEG6-t-butyl ester is a PEG reagent containing an amino NH2 group with a t-butyl protected carboxyl group (Boc). The hydrophilic PEG spacer increases solubility in aqueous media. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The t-butyl protected carboxyl group can be deprotected under acidic conditions.
This heterobifunctional, PEGylated crosslinker features an amino group at one end and t-butyl-protected carboxyl group at the other, which can be deprotected with acidic conditions. The hydrophillic PEG linker facilitates solubility in biological applications. Amino-PEG6-t-butyl ester can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or proteolysis-targeting chimeras (PROTAC molecules) for targeted protein degradation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2942000090 |
| Storage Class | 10 - Combustible liquids |






