BD5089341
4-Hydroxy-7-(trifluoromethyl)quinoline-3-carboxylicacid , 95% , 574-92-5
CAS NO.：574-92-5
Empirical Formula: C11H6F3NO3
Molecular Weight: 257.17
MDL number: MFCD00006771
EINECS: 209-377-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB80.00 | In Stock |
|
| 1g | RMB192.00 | In Stock |
|
| 5g | RMB677.60 | In Stock |
|
| 25g | RMB2312.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259-260 °C (dec.) (lit.) |
| Boiling point: | 380.3±42.0 °C(Predicted) |
| Density | 1.4646 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 0.52±0.30(Predicted) |
| InChI | 1S/C11H6F3NO3/c12-11(13,14)5-1-2-6-8(3-5)15-4-7(9(6)16)10(17)18/h1-4H,(H,15,16)(H,17,18) |
| InChIKey | BIRIVPOTERXIOW-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cnc2cc(ccc2c1O)C(F)(F)F |
| CAS DataBase Reference | 574-92-5(CAS DataBase Reference) |
Description and Uses
4-Hydroxy-7-trifluoromethyl-3-quinolinecarboxylic acid was used in the preparation of (4-hydroxy-7-trifluoromethylquinolin-3-yl)formaldehyde.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | VB2188000 |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
