BD5108241
Methyl3,5-diamino-6-chloropyrazine-2-carboxylate , 98% , 1458-01-1
Synonym(s):
Methyl 3,5-diamino-6-chloropyrazine-2-carboxylate
CAS NO.:1458-01-1
Empirical Formula: C6H7ClN4O2
Molecular Weight: 202.6
MDL number: MFCD01928388
EINECS: 215-946-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB89.60 | In Stock |
|
| 10g | RMB148.00 | In Stock |
|
| 25g | RMB289.60 | In Stock |
|
| 100g | RMB912.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-215 °C (lit.) |
| Boiling point: | 449.9±40.0 °C(Predicted) |
| Density | 1.555±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | -0.10±0.10(Predicted) |
| form | solid |
| color | Light Brown to Brown |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H7ClN4O2/c1-13-6(12)2-4(8)11-5(9)3(7)10-2/h1H3,(H4,8,9,11) |
| InChIKey | KOOBYHRLTYIPTH-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC(Cl)=C(N)N=C1N |
| CAS DataBase Reference | 1458-01-1(CAS DataBase Reference) |
Description and Uses
Amiloride USP Related Compound A
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338-P261-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2933997500 |




