BD5115241
Imidazo[1,2-a]pyridine-6-carboxylicacid , 97% , 139022-25-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB172.00 | In Stock |
|
| 10g | RMB332.00 | In Stock |
|
| 25g | RMB783.20 | In Stock |
|
| 100g | RMB3078.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250 |
| Density | 1.41 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 0.67±0.41(Predicted) |
| form | Solid |
| color | Pale Beige to Light Beige |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)6-1-2-7-9-3-4-10(7)5-6/h1-5H,(H,11,12) |
| InChIKey | ONOJJCTXSDBVSP-UHFFFAOYSA-N |
| SMILES | C12=NC=CN1C=C(C(O)=O)C=C2 |
Description and Uses
Imidazo[1,2-a]pyridine-6-carboxylic acid is a brown solid that should be stored sealed at room temperature and away from light. It is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 22-26-36/37/39-36/37 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |

![Imidazo[1,2-a]pyridine-6-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/139022-25-6.gif)

![Imidazo[1,2-a]pyridine-5-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/479028-72-3.gif)
![Imidazo[1,2-a]pyridine-3-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/6200-60-8.gif)
![Imidazo[1,2-a]pyridine-5-carbonitrile](https://img.chemicalbook.com/CAS/GIF/952511-72-7.gif)
![Imidazo[1,2-<I>a</I>]<WBR>pyridine-<WBR>6-<WBR>carbonitrile](https://img.chemicalbook.com/CAS/GIF/106850-34-4.gif)
![Imidazo[1,2-a]pyridin-7-amine](https://img.chemicalbook.com/CAS/GIF/421595-81-5.gif)