BD5121441
2,2'-(Anthracene-9,10-diylbis(methylene))dimalonicacid , 95% , 307554-62-7
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB379.20 | In Stock |
|
| 50mg | RMB587.20 | In Stock |
|
| 100mg | RMB1050.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| Boiling point: | 745.4±60.0 °C(Predicted) |
| Density | 1.527±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: soluble |
| form | A crystalline solid |
| pka | 2.90±0.30(Predicted) |
| color | Light yellow to yellow |
| BRN | 3503804 |
| InChIKey | DNUYOWCKBJFOGS-UHFFFAOYSA-N |
| SMILES | C(C1=C2C=CC=CC2=C(CC(C(=O)O)C(=O)O)C2C=CC=CC1=2)C(C(=O)O)C(=O)O |
Description and Uses
Reagent for the assay of O2; it has better characteristics than 9,10-anthracenediyl-bis-dipropionic acid.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
