BD5133541
3,3-Diphenylpropanenitrile , 97% , 2286-54-6
CAS NO.：2286-54-6
Empirical Formula: C15H13N
Molecular Weight: 207.27
MDL number: MFCD00129747
EINECS: 218-926-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB34.40 | In Stock |
|
| 5g | RMB102.40 | In Stock |
|
| 25g | RMB291.20 | In Stock |
|
| 100g | RMB820.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86 °C |
| Boiling point: | 174 °C / 3mmHg |
| Density | 1.057±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C15H13N/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11H2 |
| InChIKey | INERKLNEVAZSCI-UHFFFAOYSA-N |
| SMILES | C(CC#N)(C1C=CC=CC=1)C1C=CC=CC=1 |
| CAS DataBase Reference | 2286-54-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| RTECS | UG1700000 |
| HS Code | 2926.90.4801 |
