BD5143741
(2E,6E,10E)-3,7,11,15-Tetramethylhexadeca-2,6,10,14-tetraen-1-ol , 85% , 24034-73-9
Synonym(s):
all trans-3,7,11-15-Tetramethyl-2,6,10,14-hexadecatetraen-1-ol
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB103.20 | In Stock |
|
| 250mg | RMB132.80 | In Stock |
|
| 1g | RMB470.40 | In Stock |
|
| 5g | RMB1880.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 152-153 °C(Press: 0.07 Torr) |
| Density | 0.8930 g/cm3(Temp: 18 °C) |
| storage temp. | -20°C |
| solubility | Chloroform (Sparingly), Dichloromethane (Slightly), Ethyl Acetate (Slightly) |
| form | liquid |
| pka | 14.42±0.10(Predicted) |
| color | Colourless to Light Yellow |
| BRN | 1913779 |
| Stability: | Light Sensistive, Temperature Sensitive |
| InChI | InChI=1S/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13+,20-15+ |
| InChIKey | OJISWRZIEWCUBN-QIRCYJPOSA-N |
| SMILES | C(O)/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(/C)\C |
Description and Uses
A intermediate in the lipidation of proteins, which plays a great importance for a variety of biological processes such as cell signalling
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29052290 |
