BD5159041
4-Chloropyridine1-oxide , 95% , 1121-76-2
CAS NO.:1121-76-2
Empirical Formula: C5H4ClNO
Molecular Weight: 129.54
MDL number: MFCD00047425
EINECS: 214-336-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB50.40 | In Stock |
|
| 5g | RMB237.60 | In Stock |
|
| 25g | RMB930.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160 °C (dec.) (lit.) |
| Boiling point: | 310.0±15.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 0+-.0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C5H4ClNO/c6-5-1-3-7(8)4-2-5/h1-4H |
| InChIKey | DPJVRASYWYOFSJ-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C(Cl)C=1 |
| CAS DataBase Reference | 1121-76-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloropyridine-N-oxide(1121-76-2) |
| EPA Substance Registry System | 4-Chloropyridine 1-oxide (1121-76-2) |
Description and Uses
4-Chloropyridine N-Oxide can be used for electronic transmission material which can be used to prepare an electronic transport layer that is comprised in an electronic device which makes up a stable display device.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





