BD5491553
Nonadecanedioicacid , 98+% , 6250-70-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB188.00 | In Stock |
|
| 5g | RMB652.00 | In Stock |
|
| 25g | RMB3188.00 | In Stock |
|
| 100g | RMB9320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119.0 to 123.0 °C |
| Boiling point: | 492.6±18.0 °C(Predicted) |
| Density | 0.991±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.48±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C19H36O4/c20-18(21)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(22)23/h1-17H2,(H,20,21)(H,22,23) |
| InChIKey | IFAWYXIHOVRGHQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCCCCCCCCCCC(O)=O |
| CAS DataBase Reference | 6250-70-0 |
| EPA Substance Registry System | Nonadecanedioic acid (6250-70-0) |
Description and Uses
Nonadecanedioic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 2917.19.1700 |
