PRODUCT Properties
| Melting point: | 72-74 °C(lit.) |
| alpha | +55~+75°(D/20℃)(c=0.2,CHCl3)(after drying) |
| Boiling point: | 301.7±11.0 °C(Predicted) |
| Density | 0.95±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform: Slightly Soluble; Methanol: Slightly Soluble |
| form | A solid |
| pka | 15.18±0.29(Predicted) |
| color | White to off-white |
| Odor | at 100.00 %. woody green |
| Odor Type | woody |
| BRN | 5735560 |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C15H26O/c1-11-6-5-8-15(4)9-7-12(10-13(11)15)14(2,3)16/h12-13,16H,1,5-10H2,2-4H3/t12-,13+,15-/m1/s1 |
| InChIKey | BOPIMTNSYWYZOC-VNHYZAJKSA-N |
| SMILES | [H][C@@]12C[C@@H](CC[C@@]1(C)CCCC2=C)C(C)(C)O |
| LogP | 4.568 (est) |
| NIST Chemistry Reference | 2-Naphthalenemethanol, decahydro-«alpha»,«alpha»,4a-trimethyl-8-methylene-, [2r-(2«alpha»,4a«alpha»,8a«beta»)]-(473-15-4) |
| EPA Substance Registry System | 2-Naphthalenemethanol, decahydro-.alpha.,.alpha.,4a-trimethyl-8-methylene-, (2R,4aR,8aS)- (473-15-4) |
Description and Uses
β-Eudesmol is a sesquiterpenoid molecule that affects the central nervous system (CNS). It is known to induce neurite outgrowth. Antiangiogenic activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | QJ9698500 |
| F | 10-23 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |






