BD7590131
(cis-2-((1H-1,2,4-triazol-1-yl)methyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl)methyl methanesulfonate , 99% , 67914-86-7
CAS NO.：67914-86-7
Empirical Formula: C14H15Cl2N3O5S
Molecular Weight: 408.25
MDL number: MFCD06410887
EINECS: 267-749-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB48.00 | In Stock |
|
| 25g | RMB169.60 | In Stock |
|
| 100g | RMB612.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98 °C |
| Boiling point: | 615.5±65.0 °C(Predicted) |
| Density | 1.59±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.94±0.12(Predicted) |
| color | White to Off-White |
| InChI | InChI=1/C14H15Cl2N3O5S/c1-25(20,21)23-6-11-5-22-14(24-11,7-19-9-17-8-18-19)12-3-2-10(15)4-13(12)16/h2-4,8-9,11H,5-7H2,1H3/t11-,14+/s3 |
| InChIKey | QIMASXGTWQEFGS-LNBRXUOKNA-N |
| SMILES | C(N1N=CN=C1)[C@]1(C2C=CC(Cl)=CC=2Cl)OC[C@H](COS(=O)(=O)C)O1 |&1:6,17,r| |
| CAS DataBase Reference | 67914-86-7(CAS DataBase Reference) |
Description and Uses
An intermediate in the synthesis of Itraconazole.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310+P330-P405-P501 |
