BD7603431
6-Chloro-5-(2-chloroethyl)indolin-2-one , 97% , 118289-55-7
CAS NO.：118289-55-7
Empirical Formula: C10H9Cl2NO
Molecular Weight: 230.09
MDL number: MFCD03411598
EINECS: 421-320-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB129.60 | In Stock |
|
| 25g | RMB592.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-221℃ |
| Boiling point: | 393.8±42.0 °C(Predicted) |
| Density | 1.376±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Dimethylformamide |
| form | Powder |
| pka | 13.23±0.20(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C10H9Cl2NO/c11-2-1-6-3-7-4-10(14)13-9(7)5-8(6)12/h3,5H,1-2,4H2,(H,13,14) |
| InChIKey | ZTQQXEPZEYIVDK-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(CCCl)C(Cl)=C2)CC1=O |
| LogP | 2.93 at 20℃ |
| CAS DataBase Reference | 118289-55-7(CAS DataBase Reference) |
Description and Uses
6-Chloro-5-(2-chloroethyl)oxindole (cas# 118289-55-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61-24/25 |
| RIDADR | 3077 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29339900 |
