BD7609031
1-Boc-2-(Aminomethyl)piperidine , 98% , 370069-31-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB53.60 | In Stock |
|
| 1g | RMB119.20 | In Stock |
|
| 5g | RMB469.60 | In Stock |
|
| 10g | RMB912.00 | In Stock |
|
| 25g | RMB1790.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 299.4±13.0 °C(Predicted) |
| Density | 1.0124 g/mL at 25 °C |
| refractive index | n20/D 1.4745 |
| Flash point: | 110 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Soluble in DMSO. |
| form | liquid |
| pka | 10.32±0.29(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | -0.1°(C=0.01 g/ml CHCL3) |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-7-5-4-6-9(13)8-12/h9H,4-8,12H2,1-3H3 |
| InChIKey | PTVRCUVHYMGECC-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCCC1CN |
| CAS DataBase Reference | 370069-31-1(CAS DataBase Reference) |
Description and Uses
Reactant for synthesis of:
TRPV1 antagonists
CHK1 inhibitors
p38a MAP kinase inhibitors
Carbamoylphosphonates
Macrolactams via carbonylation/intramolecular amidation
Intramolecular transamidation
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H400 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-50 |
| Safety Statements | 26-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | 9 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




