BD7609131
tert-Butyl 3-(aminomethyl)piperidine-1-carboxylate , 97% , 162167-97-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB83.20 | In Stock |
|
| 5g | RMB220.80 | In Stock |
|
| 10g | RMB376.80 | In Stock |
|
| 25g | RMB738.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 299.4±13.0 °C(Predicted) |
| Density | 0.995 g/mL at 25 °C |
| refractive index | n20/D1.469 |
| Flash point: | >110℃ |
| storage temp. | 2-8°C |
| pka | 10.12±0.29(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | 1S/C11H22N2O2/c1-11(2,3)15-10(14)13-6-4-5-9(7-12)8-13/h9H,4-8,12H2,1-3H3 |
| InChIKey | WPWXYQIMXTUMJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CN)C1 |
| CAS DataBase Reference | 162167-97-7(CAS DataBase Reference) |
Description and Uses
3-Aminomethyl-1-Boc-piperidine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H400 |
| Precautionary statements | P273-P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 22-36-50/53 |
| Safety Statements | 26-60-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 |




