BD7609931
5-Phenylthiophene-2-carbaldehyde , 98% , 19163-21-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB85.60 | In Stock |
|
| 1g | RMB213.60 | In Stock |
|
| 5g | RMB570.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95 °C (lit.) |
| Boiling point: | 105 °C(Press: 0.25 Torr) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | 1S/C11H8OS/c12-8-10-6-7-11(13-10)9-4-2-1-3-5-9/h1-8H |
| InChIKey | APWHJDHTLFVWSQ-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(s1)-c2ccccc2 |
| CAS DataBase Reference | 19163-21-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
