BD7645531
5-Bromo-2-(hydroxymethyl)phenol , 95% , 170434-11-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB124.00 | In Stock |
|
| 250mg | RMB164.80 | In Stock |
|
| 1g | RMB619.20 | In Stock |
|
| 5g | RMB1829.60 | In Stock |
|
| 10g | RMB2980.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 281.8±10.0 °C(Predicted) |
| Density | 1.722±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.96±0.10(Predicted) |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C7H7BrO2/c8-6-2-1-5(4-9)7(10)3-6/h1-3,9-10H,4H2 |
| InChIKey | CHVJSQNPFPRTPB-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=C(Br)C=C1O |
Description and Uses
5-Bromo-2-(hydroxymethyl)phenol is a useful reactant for the synthesis of alkylated barbituric acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P280 |
| HS Code | 2909500090 |
