PRODUCT Properties
| Melting point: | 40.0-40.5 °C(Solv: water (7732-18-5); methanol (67-56-1)) |
| Boiling point: | 230.0±20.0 °C(Predicted) |
| Density | 1.274±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Solid |
| color | Yellow |
| InChI | InChI=1S/C7H6FNO2/c1-5-2-6(8)4-7(3-5)9(10)11/h2-4H,1H3 |
| InChIKey | IPMURRZVEWZEPP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC([N+]([O-])=O)=CC(C)=C1 |
| CAS DataBase Reference | 499-08-1(CAS DataBase Reference) |
Description and Uses
3-Fluoro-5-nitrotoluene is mainly used as an intermediate in the pharmaceutical, chemical and material industries, especially in the synthesis of certain drugs and pesticide products.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2904990090 |
