BD7688431
(4-Bromo-2-fluorophenyl)methanamine , 98% , 112734-22-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB52.00 | In Stock |
|
| 5g | RMB179.20 | In Stock |
|
| 25g | RMB647.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 244.5±25.0 °C(Predicted) |
| Density | 1.571±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 8.43±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.58 |
| color | Clear colorless to slightly yellow |
| InChI | InChI=1S/C7H7BrFN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2 |
| InChIKey | RLTFBWCBGIZCDQ-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 112734-22-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P362+P364-P303+P361+P353-P301+P330+P331-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P405 |
| Hazard Codes | C,Xi |
| Risk Statements | 34-21/22-36 |
| Safety Statements | 45-36/37/39-26 |
| RIDADR | 2735 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29214900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
