BD7697731
tert-Butyl (2-hydrazinyl-2-oxoethyl)carbamate , 95% , 6926-09-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 1g | RMB56.00 | In Stock |
|
| 5g | RMB208.80 | In Stock |
|
| 10g | RMB392.80 | In Stock |
|
| 25g | RMB757.60 | In Stock |
|
| 100g | RMB2810.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-115 |
| Boiling point: | 386.5±25.0 °C(Predicted) |
| Density | 1.139±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | solid |
| pka | 11.40±0.46(Predicted) |
| color | Beige |
| InChI | InChI=1S/C7H15N3O3/c1-7(2,3)13-6(12)9-4-5(11)10-8/h4,8H2,1-3H3,(H,9,12)(H,10,11) |
| InChIKey | MQBASTZLTYLEON-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)CNC(OC(C)(C)C)=O |
Description and Uses
Boc-Glycine hydrazide is used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P260-P280 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| HazardClass | IRRITANT |
| HS Code | 2928009090 |
