BD7698031
Boc-Leu-OSu , 96% , 3392-09-4
Synonym(s):
N-(tert-Butoxycarbonyl)-L -leucine N-hydroxysuccinimide ester;Boc-L -leucine hydroxysuccinimide ester
CAS NO.:3392-09-4
Empirical Formula: C15H24N2O6
Molecular Weight: 328.36
MDL number: MFCD00037913
EINECS: 222-232-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5g | RMB88.00 | In Stock |
|
| 25g | RMB402.40 | In Stock |
|
| 100g | RMB1256.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-113 °C(lit.) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| pka | 10.81±0.46(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 43.5±1°, c = 1% in dioxane |
| BRN | 4538026 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C15H24N2O6/c1-9(2)8-10(16-14(21)22-15(3,4)5)13(20)23-17-11(18)6-7-12(17)19/h9-10H,6-8H2,1-5H3,(H,16,21)/t10-/m0/s1 |
| InChIKey | WXRGJQZMGGGTSS-JTQLQIEISA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)[C@H](CC(C)C)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 3392-09-4(CAS DataBase Reference) |
Description and Uses
peptide synthesis







