BD7699131
(Z)-3-Methylpent-2-en-4-yn-1-ol , 97% , 6153-05-5
CAS NO.:6153-05-5
Empirical Formula: C6H8O
Molecular Weight: 96.13
MDL number: MFCD00063203
EINECS: 228-168-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB104.00 | In Stock |
|
| 5g | RMB372.80 | In Stock |
|
| 25g | RMB1549.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 171°C |
| Density | 0.940 |
| refractive index | 1.4445-1.4465 |
| Flash point: | 65°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| pka | 13.80±0.10(Predicted) |
| color | Yellow to Dark Yellow |
| InChI | InChI=1S/C6H8O/c1-3-6(2)4-5-7/h1,4,7H,5H2,2H3/b6-4- |
| InChIKey | ZSJHASYJQIRSLE-XQRVVYSFSA-N |
| SMILES | C(O)/C=C(/C)\C#C |
Description and Uses
(Z)-3-Methylpent-2-en-4-yn-1-ol is used as a reagent in organic synthesis of many compounds including that of prolycopene which is a tangerine-colored tetra-Z-isomer of lycopene that is found in fruits of the tangerine tomato. Z)-3-Methylpent-2-en-4-yn-1-ol is also used in the synthesis of Leucosceptroids A and B which have potent antifungal properties.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H319 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P261-P264-P270-P271-P280-P301+P310+P330-P303+P361+P353-P304+P340+P311-P305+P351+P338-P337+P313-P370+P378-P403+P233-P403+P235-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 1760 |
| HazardClass | 8 |
| PackingGroup | III |








