BD7715931
5-Chloro-2-nitrophenol , 97% , 611-07-4
CAS NO.:611-07-4
Empirical Formula: C6H4ClNO3
Molecular Weight: 173.55
MDL number: MFCD09260849
EINECS: 210-249-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5g | RMB148.00 | In Stock |
|
| 10g | RMB235.20 | In Stock |
|
| 25g | RMB488.80 | In Stock |
|
| 100g | RMB1480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41°C |
| Boiling point: | 247.6±20.0 °C(Predicted) |
| Density | 1.4914 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| pka | 6.08±0.13(Predicted) |
| color | yellow |
| InChI | InChI=1S/C6H4ClNO3/c7-4-1-2-5(8(10)11)6(9)3-4/h1-3,9H |
| InChIKey | MZDBQSFPAMTTIS-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(Cl)=CC=C1[N+]([O-])=O |
| NIST Chemistry Reference | 5-Chloro-2-nitrophenol(611-07-4) |
| EPA Substance Registry System | Phenol, 5-chloro-2-nitro- (611-07-4) |
Description and Uses
5-Chloro-2-nitrophenol is used in organic synthesis. It is the starting material for the synthesis of 7-chloro-2H-1,4-benzoxazin-3(4H)-one.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H410 |
| Precautionary statements | P261-P264-P270-P272-P273-P280-P301+P312+P330-P302+P352-P305+P351+P338+P310-P333+P313-P391-P501 |
| HazardClass | IRRITANT |
| HS Code | 2921490090 |





