BD7734531
6-Chloro-1H-pyrrolo[2,3-b]pyridine , 95% , 55052-27-2
CAS NO.:55052-27-2
Empirical Formula: C7H5ClN2
Molecular Weight: 152.58
MDL number: MFCD06659666
EINECS: 809-416-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB42.40 | In Stock |
|
| 1g | RMB80.00 | In Stock |
|
| 5g | RMB294.40 | In Stock |
|
| 10g | RMB569.60 | In Stock |
|
| 25g | RMB1341.60 | In Stock |
|
| 100g | RMB3885.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-175℃ |
| Boiling point: | 420.7±37.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 6.76±0.40(Predicted) |
| form | Powder |
| color | White to pale brown |
| InChI | InChI=1S/C7H5ClN2/c8-6-2-1-5-3-4-9-7(5)10-6/h1-4H,(H,9,10) |
| InChIKey | DSCOSIUAQUDGJM-UHFFFAOYSA-N |
| SMILES | C12NC=CC1=CC=C(Cl)N=2 |
Description and Uses
6-Chloro-1H-pyrrolo[2,3-b]pyridine is used in the preparation of heterocyclic compounds for the use of treatment of cancer.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| RIDADR | UN2811 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |

![6-Chloro-1H-pyrrolo[2,3-b]pyridine](https://img.chemicalbook.com/CAS/GIF/55052-27-2.gif)




![6-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/800402-07-7.gif)
![6-Chloro-1H-pyrrolo[2,3-b]pyridin-4-amine](https://img.chemicalbook.com/CAS/GIF/1000340-80-6.gif)
![6-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/915140-96-4.gif)