BD7771331
Methyl 2-amino-3-chlorobenzoate , 97% , 77820-58-7
CAS NO.:77820-58-7
Empirical Formula: C8H8ClNO2
Molecular Weight: 185.61
MDL number: MFCD06797833
EINECS: 620-109-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB35.20 | In Stock |
|
| 10g | RMB48.00 | In Stock |
|
| 25g | RMB98.40 | In Stock |
|
| 100g | RMB278.40 | In Stock |
|
| 500g | RMB1300.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-37°C |
| Boiling point: | 273.8±20.0 °C(Predicted) |
| Density | 1.311±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 0.25±0.10(Predicted) |
| form | powder to lump |
| color | White to Light yellow |
| InChI | InChI=1S/C8H8ClNO2/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4H,10H2,1H3 |
| InChIKey | MSXSZFYRADEEJA-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(Cl)=C1N |
| CAS DataBase Reference | 77820-58-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-amino-3-chloro-, methyl ester (77820-58-7) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HS Code | 2922390090 |
| REACH Registrations | Active |







