BD7787231
(3-(Dimethylcarbamoyl)phenyl)boronic acid , 98% , 373384-14-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB58.40 | In Stock |
|
| 1g | RMB122.40 | In Stock |
|
| 5g | RMB436.00 | In Stock |
|
| 10g | RMB845.60 | In Stock |
|
| 25g | RMB2047.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-128°C |
| Boiling point: | 423.0±47.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 7.94±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C9H12BNO3/c1-11(2)9(12)7-4-3-5-8(6-7)10(13)14/h3-6,13-14H,1-2H3 |
| InChIKey | DCXXIDMHTQDSLY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(C(N(C)C)=O)=C1)(O)O |
| CAS DataBase Reference | 373384-14-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |







