BD7792531
5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate , 95% , 83763-48-8
CAS NO.:83763-48-8
Empirical Formula: C9H16N2O6S
Molecular Weight: 280.3
MDL number: MFCD00467095
EINECS: 280-734-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB52.80 | In Stock |
|
| 1g | RMB96.80 | In Stock |
|
| 5g | RMB332.80 | In Stock |
|
| 25g | RMB996.80 | In Stock |
|
| 100g | RMB3584.00 | In Stock |
|
| 500g | RMB11110.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-154℃ |
| Density | 1.541[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol (Slightly), DMSO (Slightly) |
| form | Solid |
| color | Grey to Very Dark Grey |
| Water Solubility | 81.9g/L at 20℃ |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate (83763-48-8) |
| InChI | InChI=1S/C9H14N2O2.H2O4S/c1-13-9-3-2-7(6-8(9)10)11-4-5-12;1-5(2,3)4/h2-3,6,11-12H,4-5,10H2,1H3;(H2,1,2,3,4) |
| InChIKey | GWHLYFOWAINYAH-UHFFFAOYSA-N |
| SMILES | C1(NCCO)=CC=C(OC)C(N)=C1.S(=O)(=O)(O)O |
| LogP | 0.59 at 20℃ |
| CAS DataBase Reference | 83763-48-8(CAS DataBase Reference) |
Description and Uses
5-(2-Hydroxyethylamino)-2-methoxylaniline Sulfate can be used to color and straighten keratin fibers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |





