BD7810431
2,2,2-Triphenylacetic acid , 97% , 595-91-5
Synonym(s):
Tritylformic acid
CAS NO.：595-91-5
Empirical Formula: C20H16O2
Molecular Weight: 288.35
MDL number: MFCD00004185
EINECS: 209-873-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB232.80 | In Stock |
|
| 10g | RMB442.40 | In Stock |
|
| 25g | RMB1034.40 | In Stock |
|
| 100g | RMB3259.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-273 °C (lit.) |
| Boiling point: | 390.57°C (rough estimate) |
| Density | 1.0992 (rough estimate) |
| refractive index | 1.7580 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Fine Crystalline Powder |
| pka | pK1:3.96 (25°C) |
| color | White to beige |
| InChI | InChI=1S/C20H16O2/c21-19(22)20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H,21,22) |
| InChIKey | DCYGAPKNVCQNOE-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)C(=O)O |
| CAS DataBase Reference | 595-91-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Triphenylacetic acid(595-91-5) |
Description and Uses
2,2,2-Triphenylacetic Acid is used in preparation of Rhodium(II) Tetramethyl-benzenedipropioate complex, other Carboxylate complexes, and their catalytic activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
