BD7819631
3',4'-(Methylenedioxy)acetophenone , 98% , 3162-29-6
CAS NO.:3162-29-6
Empirical Formula: C9H8O3
Molecular Weight: 164.16
MDL number: MFCD00005831
EINECS: 221-613-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB59.20 | In Stock |
|
| 10g | RMB101.60 | In Stock |
|
| 25g | RMB201.60 | In Stock |
|
| 100g | RMB720.00 | In Stock |
|
| 500g | RMB2912.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-89 °C(lit.) |
| Boiling point: | 152-155°C 15mm |
| Density | 1.2132 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| Flash point: | 152-155°C/15mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | Beige |
| Odor | Heavy, sweet-floral and warm-herbaceous odor |
| Water Solubility | Slightly soluble in water. |
| BRN | 139669 |
| InChI | InChI=1S/C9H8O3/c1-6(10)7-2-3-8-9(4-7)12-5-11-8/h2-4H,5H2,1H3 |
| InChIKey | BMHMKWXYXFBWMI-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C2OCOC2=C1)C |
| CAS DataBase Reference | 3162-29-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3',4'-(Methylenedioxy)acetophenone(3162-29-6) |
Description and Uses
3?,4?-(Methylenedioxy)acetophenone is used in the synthesis of N-ethyl-1-(3,4-methylenedioxyphenyl)ethylamine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |





![[(3S,4R)-4-Phenyl-1-methylpiperidinyl]methanol](https://img.chemicalbook.com/CAS/20180906/GIF/176022-03-0.gif)
![Benzo[d][1,3]dioxol-4-ol](https://img.chemicalbook.com/CAS/20180531/GIF/69393-72-2.gif)
