BD7842031
3-Bromofuran-2,5-dione , 97% , 5926-51-2
Synonym(s):
3-Bromo-2,5-dihydrofuran-2,5-dione;3-Bromo-2,5-furandione
CAS NO.：5926-51-2
Empirical Formula: C4HBrO3
Molecular Weight: 176.95
MDL number: MFCD00005519
EINECS: 227-659-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB183.20 | In Stock |
|
| 10g | RMB356.80 | In Stock |
|
| 25g | RMB869.60 | In Stock |
|
| 100g | RMB3404.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 215 °C(lit.) |
| Density | 1.905 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Solid-liquid mixture |
| InChI | InChI=1S/C4HBrO3/c5-2-1-3(6)8-4(2)7/h1H |
| InChIKey | YPRMWCKXOZFJGF-UHFFFAOYSA-N |
| SMILES | O1C(=O)C=C(Br)C1=O |
Description and Uses
3-Bromofuran-2,5-dione is used to study reversible or permanent chemical modification of proteins and peptides by control of maleimide hydrolysis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29171990 |
