BD7854031
3-(3-Methylphenyl)propionic acid , 98% , 3751-48-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB49.60 | In Stock |
|
| 250mg | RMB102.40 | In Stock |
|
| 1g | RMB137.60 | In Stock |
|
| 5g | RMB419.20 | In Stock |
|
| 10g | RMB772.00 | In Stock |
|
| 25g | RMB1856.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-42 °C (lit.) |
| Boiling point: | 290℃ |
| Density | 1.097 |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetone, DMSO, Methanol |
| form | Solid |
| pka | pK1:4.677 (25°C) |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C10H12O2/c1-8-3-2-4-9(7-8)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| InChIKey | VWXVTHDQAOAENP-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=CC(C)=C1 |
| CAS DataBase Reference | 3751-48-2(CAS DataBase Reference) |
Description and Uses
3-m-Tolylpropanoic Acid is used in the synthesis of piperidine antagonists as CCR1-selective inhibitors. via parallel synthesis. Also used in the synthesis of small molecule antagonists of vasoactive intestinal. peptide receptor1 (VIPR1).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41-36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







