BD7861031
Chloromethyl ethyl carbonate , 97% , 35179-98-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB33.60 | In Stock |
|
| 250mg | RMB44.00 | In Stock |
|
| 1g | RMB154.40 | In Stock |
|
| 5g | RMB608.00 | In Stock |
|
| 10g | RMB1059.20 | In Stock |
|
| 25g | RMB1724.00 | In Stock |
|
| 100g | RMB6776.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 135.1±23.0 °C(Predicted) |
| Density | 1.196±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Colourless Oil with White Particles |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C4H7ClO3/c1-2-7-4(6)8-3-5/h2-3H2,1H3 |
| InChIKey | RTFGZMKXMSDULM-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)OCCl |
Description and Uses
As a reagent, Chloromethyl ethyl carbonate can be used in the preparation of hepatitis C virus NS3 protease inhibitors and PMPA prodrugs with antiretroviral activity.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H226 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| RIDADR | 1993 |
| HazardClass | 3 |
| PackingGroup | Ⅲ |
| HS Code | 2920901090 |
